C20H19ClN6O4S — CID 22994068
5-[3-(5-amino-2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine (PubChem CID 22994068) has the molecular formula C20H19ClN6O4S and a molecular weight of 474.93 g/mol. Its IUPAC name is 5-[3-(5-amino-2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine.
| Compound Name | 5-[3-(5-amino-2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 22994068 |
| Molecular Formula | C20H19ClN6O4S |
| Molecular Weight | 474.93 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 5-[3-(5-amino-2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine |
| SMILES | COc1cc(Nc2nc(N)c(-c3nc(-c4cc(N)ccc4Cl)no3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C20H19ClN6O4S/c1-28-13-7-10(8-14(29-2)15(13)30-3)24-20-25-17(23)16(32-20)19-26-18(27-31-19)11-6-9(22)4-5-12(11)21/h4-8H,22-23H2,1-3H3,(H,24,25) |
| InChIKey | UFQHDYLQSUOOPZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 143.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.93 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|