About N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-(4-methylphenyl)-3-nitrobenzamide
N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-(4-methylphenyl)-3-nitrobenzamide (PubChem CID 2299468) has the molecular formula C26H23N3O5
and a molecular weight of 457.49 g/mol. Its IUPAC name is N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-(4-methylphenyl)-3-nitrobenzamide.
Molecular Properties
| Compound Name | N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-(4-methylphenyl)-3-nitrobenzamide |
| PubChem CID | 2299468 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-(4-methylphenyl)-3-nitrobenzamide |
| SMILES | Cc1ccc(N(CCCCN2C(=O)c3ccccc3C2=O)C(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H23N3O5/c1-18-11-13-20(14-12-18)27(24(30)19-7-6-8-21(17-19)29(33)34)15-4-5-16-28-25(31)22-9-2-3-10-23(22)26(28)32/h2-3,6-14,17H,4-5,15-16H2,1H3 |
| InChIKey | IPGGCLIQQLHICC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-(4-methylphenyl)-3-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-(4-methylphenyl)-3-nitrobenzamide?
The IUPAC name of N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-(4-methylphenyl)-3-nitrobenzamide (CID 2299468) is N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-(4-methylphenyl)-3-nitrobenzamide.
What is the SMILES notation for N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-(4-methylphenyl)-3-nitrobenzamide?
The canonical SMILES for N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-(4-methylphenyl)-3-nitrobenzamide is Cc1ccc(N(CCCCN2C(=O)c3ccccc3C2=O)C(=O)c2cccc([N+](=O)[O-])c2)cc1.
What is the InChIKey of N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-(4-methylphenyl)-3-nitrobenzamide?
The InChIKey is IPGGCLIQQLHICC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23N3O5/c1-18-11-13-20(14-12-18)27(24(30)19-7-6-8-21(17-19)29(33)34)15-4-5-16-28-25(31)22-9-2-3-10-23(22)26(28)32/h2-3,6-14,17H,4-5,15-16H2,1H3.
What are the key properties of N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-(4-methylphenyl)-3-nitrobenzamide?
N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-(4-methylphenyl)-3-nitrobenzamide has a molecular weight of 457.49 g/mol, XLogP of 4.63, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-(4-methylphenyl)-3-nitrobenzamide is sourced from PubChem (CID 2299468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).