C10H14O — CID 22995355
2-methyl-3,4,4a,5-tetrahydro-2H-chromene (PubChem CID 22995355) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-methyl-3,4,4a,5-tetrahydro-2H-chromene.
| Compound Name | 2-methyl-3,4,4a,5-tetrahydro-2H-chromene |
|---|---|
| PubChem CID | 22995355 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-methyl-3,4,4a,5-tetrahydro-2H-chromene |
| SMILES | CC1CCC2CC=CC=C2O1 |
| InChI | InChI=1S/C10H14O/c1-8-6-7-9-4-2-3-5-10(9)11-8/h2-3,5,8-9H,4,6-7H2,1H3 |
| InChIKey | AFVPMPMMFPBBOS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |