About ethyl (E)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate
ethyl (E)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate (PubChem CID 22995359) has the molecular formula C7H6F6O5S
and a molecular weight of 316.18 g/mol. Its IUPAC name is ethyl (E)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate |
| PubChem CID | 22995359 |
| Molecular Formula | C7H6F6O5S |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | ethyl (E)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate |
| SMILES | CCOC(=O)/C=C(/OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F6O5S/c1-2-17-5(14)3-4(6(8,9)10)18-19(15,16)7(11,12)13/h3H,2H2,1H3/b4-3+ |
| InChIKey | BDUFKYMWNPONCZ-ONEGZZNKSA-N |
| XLogP | 1.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate?
The IUPAC name of ethyl (E)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate (CID 22995359) is ethyl (E)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate.
What is the SMILES notation for ethyl (E)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate?
The canonical SMILES for ethyl (E)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate is CCOC(=O)/C=C(/OS(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of ethyl (E)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate?
The InChIKey is BDUFKYMWNPONCZ-ONEGZZNKSA-N. The full InChI is InChI=1S/C7H6F6O5S/c1-2-17-5(14)3-4(6(8,9)10)18-19(15,16)7(11,12)13/h3H,2H2,1H3/b4-3+.
What are the key properties of ethyl (E)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate?
ethyl (E)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate has a molecular weight of 316.18 g/mol, XLogP of 1.86, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate is sourced from PubChem (CID 22995359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).