C27H24F2N2O5 — CID 2299545
N-(2,4-difluorophenyl)-N-[4-(1,3-dioxoisoindol-2-yl)butyl]-3,5-dimethoxybenzamide (PubChem CID 2299545) has the molecular formula C27H24F2N2O5 and a molecular weight of 494.49 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N-[4-(1,3-dioxoisoindol-2-yl)butyl]-3,5-dimethoxybenzamide.
| Compound Name | N-(2,4-difluorophenyl)-N-[4-(1,3-dioxoisoindol-2-yl)butyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 2299545 |
| Molecular Formula | C27H24F2N2O5 |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | N-(2,4-difluorophenyl)-N-[4-(1,3-dioxoisoindol-2-yl)butyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N(CCCCN2C(=O)c3ccccc3C2=O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C27H24F2N2O5/c1-35-19-13-17(14-20(16-19)36-2)25(32)30(24-10-9-18(28)15-23(24)29)11-5-6-12-31-26(33)21-7-3-4-8-22(21)27(31)34/h3-4,7-10,13-16H,5-6,11-12H2,1-2H3 |
| InChIKey | OCUHFLCPQSCRPV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|