About (5-amino-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)urea
(5-amino-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)urea (PubChem CID 22995853) has the molecular formula C5H9N5O2
and a molecular weight of 171.16 g/mol. Its IUPAC name is (5-amino-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)urea.
Molecular Properties
| Compound Name | (5-amino-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)urea |
| PubChem CID | 22995853 |
| Molecular Formula | C5H9N5O2 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | (5-amino-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)urea |
| SMILES | NC(=O)NC1=NCC(N)C(=O)N1 |
| InChI | InChI=1S/C5H9N5O2/c6-2-1-8-5(9-3(2)11)10-4(7)12/h2H,1,6H2,(H4,7,8,9,10,11,12) |
| InChIKey | HAIVDMSEEFROIX-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-amino-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)urea?
The IUPAC name of (5-amino-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)urea (CID 22995853) is (5-amino-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)urea.
What is the SMILES notation for (5-amino-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)urea?
The canonical SMILES for (5-amino-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)urea is NC(=O)NC1=NCC(N)C(=O)N1.
What is the InChIKey of (5-amino-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)urea?
The InChIKey is HAIVDMSEEFROIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5O2/c6-2-1-8-5(9-3(2)11)10-4(7)12/h2H,1,6H2,(H4,7,8,9,10,11,12).
What are the key properties of (5-amino-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)urea?
(5-amino-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)urea has a molecular weight of 171.16 g/mol, XLogP of -2.53, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)urea is sourced from PubChem (CID 22995853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).