About 2-[(3,4,5-trimethoxyphenyl)methyl]-1-benzothiophene-3-sulfonyl chloride
2-[(3,4,5-trimethoxyphenyl)methyl]-1-benzothiophene-3-sulfonyl chloride (PubChem CID 22998421) has the molecular formula C18H17ClO5S2
and a molecular weight of 412.92 g/mol. Its IUPAC name is 2-[(3,4,5-trimethoxyphenyl)methyl]-1-benzothiophene-3-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-[(3,4,5-trimethoxyphenyl)methyl]-1-benzothiophene-3-sulfonyl chloride |
| PubChem CID | 22998421 |
| Molecular Formula | C18H17ClO5S2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 2-[(3,4,5-trimethoxyphenyl)methyl]-1-benzothiophene-3-sulfonyl chloride |
| SMILES | COc1cc(Cc2sc3ccccc3c2S(=O)(=O)Cl)cc(OC)c1OC |
| InChI | InChI=1S/C18H17ClO5S2/c1-22-13-8-11(9-14(23-2)17(13)24-3)10-16-18(26(19,20)21)12-6-4-5-7-15(12)25-16/h4-9H,10H2,1-3H3 |
| InChIKey | LXGVDSWNNGBJEJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3,4,5-trimethoxyphenyl)methyl]-1-benzothiophene-3-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4,5-trimethoxyphenyl)methyl]-1-benzothiophene-3-sulfonyl chloride?
The IUPAC name of 2-[(3,4,5-trimethoxyphenyl)methyl]-1-benzothiophene-3-sulfonyl chloride (CID 22998421) is 2-[(3,4,5-trimethoxyphenyl)methyl]-1-benzothiophene-3-sulfonyl chloride.
What is the SMILES notation for 2-[(3,4,5-trimethoxyphenyl)methyl]-1-benzothiophene-3-sulfonyl chloride?
The canonical SMILES for 2-[(3,4,5-trimethoxyphenyl)methyl]-1-benzothiophene-3-sulfonyl chloride is COc1cc(Cc2sc3ccccc3c2S(=O)(=O)Cl)cc(OC)c1OC.
What is the InChIKey of 2-[(3,4,5-trimethoxyphenyl)methyl]-1-benzothiophene-3-sulfonyl chloride?
The InChIKey is LXGVDSWNNGBJEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClO5S2/c1-22-13-8-11(9-14(23-2)17(13)24-3)10-16-18(26(19,20)21)12-6-4-5-7-15(12)25-16/h4-9H,10H2,1-3H3.
What are the key properties of 2-[(3,4,5-trimethoxyphenyl)methyl]-1-benzothiophene-3-sulfonyl chloride?
2-[(3,4,5-trimethoxyphenyl)methyl]-1-benzothiophene-3-sulfonyl chloride has a molecular weight of 412.92 g/mol, XLogP of 4.45, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4,5-trimethoxyphenyl)methyl]-1-benzothiophene-3-sulfonyl chloride is sourced from PubChem (CID 22998421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).