C16H26ClNO — CID 22998596
6-[4-(dimethylamino)butyl]-5,6,7,8-tetrahydronaphthalen-2-ol;hydrochloride (PubChem CID 22998596) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is 6-[4-(dimethylamino)butyl]-5,6,7,8-tetrahydronaphthalen-2-ol;hydrochloride.
| Compound Name | 6-[4-(dimethylamino)butyl]-5,6,7,8-tetrahydronaphthalen-2-ol;hydrochloride |
|---|---|
| PubChem CID | 22998596 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 6-[4-(dimethylamino)butyl]-5,6,7,8-tetrahydronaphthalen-2-ol;hydrochloride |
| SMILES | CN(C)CCCCC1CCc2cc(O)ccc2C1.Cl |
| InChI | InChI=1S/C16H25NO.ClH/c1-17(2)10-4-3-5-13-6-7-15-12-16(18)9-8-14(15)11-13;/h8-9,12-13,18H,3-7,10-11H2,1-2H3;1H |
| InChIKey | CVBIKMVCRVANLL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|