About 2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)acetate
2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)acetate (PubChem CID 22998642) has the molecular formula C11H10NO4-
and a molecular weight of 220.20 g/mol. Its IUPAC name is 2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)acetate.
Molecular Properties
| Compound Name | 2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)acetate |
| PubChem CID | 22998642 |
| Molecular Formula | C11H10NO4- |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)acetate |
| SMILES | O=C([O-])CC1Cc2ccc(O)cc2NC1=O |
| InChI | InChI=1S/C11H11NO4/c13-8-2-1-6-3-7(4-10(14)15)11(16)12-9(6)5-8/h1-2,5,7,13H,3-4H2,(H,12,16)(H,14,15)/p-1 |
| InChIKey | SEMWTIRBHPFOJB-UHFFFAOYSA-M |
| XLogP | -0.36 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)acetate?
The IUPAC name of 2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)acetate (CID 22998642) is 2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)acetate.
What is the SMILES notation for 2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)acetate?
The canonical SMILES for 2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)acetate is O=C([O-])CC1Cc2ccc(O)cc2NC1=O.
What is the InChIKey of 2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)acetate?
The InChIKey is SEMWTIRBHPFOJB-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H11NO4/c13-8-2-1-6-3-7(4-10(14)15)11(16)12-9(6)5-8/h1-2,5,7,13H,3-4H2,(H,12,16)(H,14,15)/p-1.
What are the key properties of 2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)acetate?
2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)acetate has a molecular weight of 220.20 g/mol, XLogP of -0.36, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-3-yl)acetate is sourced from PubChem (CID 22998642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).