About cyclopentanesulfonamide;1-methylnaphthalene
cyclopentanesulfonamide;1-methylnaphthalene (PubChem CID 22999254) has the molecular formula C16H21NO2S
and a molecular weight of 291.42 g/mol. Its IUPAC name is cyclopentanesulfonamide;1-methylnaphthalene.
Molecular Properties
| Compound Name | cyclopentanesulfonamide;1-methylnaphthalene |
| PubChem CID | 22999254 |
| Molecular Formula | C16H21NO2S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | cyclopentanesulfonamide;1-methylnaphthalene |
| SMILES | Cc1cccc2ccccc12.NS(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C11H10.C5H11NO2S/c1-9-5-4-7-10-6-2-3-8-11(9)10;6-9(7,8)5-3-1-2-4-5/h2-8H,1H3;5H,1-4H2,(H2,6,7,8) |
| InChIKey | HHKWKKBOWWALQB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopentanesulfonamide;1-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanesulfonamide;1-methylnaphthalene?
The IUPAC name of cyclopentanesulfonamide;1-methylnaphthalene (CID 22999254) is cyclopentanesulfonamide;1-methylnaphthalene.
What is the SMILES notation for cyclopentanesulfonamide;1-methylnaphthalene?
The canonical SMILES for cyclopentanesulfonamide;1-methylnaphthalene is Cc1cccc2ccccc12.NS(=O)(=O)C1CCCC1.
What is the InChIKey of cyclopentanesulfonamide;1-methylnaphthalene?
The InChIKey is HHKWKKBOWWALQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10.C5H11NO2S/c1-9-5-4-7-10-6-2-3-8-11(9)10;6-9(7,8)5-3-1-2-4-5/h2-8H,1H3;5H,1-4H2,(H2,6,7,8).
What are the key properties of cyclopentanesulfonamide;1-methylnaphthalene?
cyclopentanesulfonamide;1-methylnaphthalene has a molecular weight of 291.42 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanesulfonamide;1-methylnaphthalene is sourced from PubChem (CID 22999254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).