3-chloro-4-hydroxybenzenesulfonyl chloride

C6H4Cl2O3S — CID 22999325

IUPAC3-chloro-4-hydroxybenzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(O)c(Cl)c1
InChIInChI=1S/C6H4Cl2O3S/c7-5-3-4(12(8,10)11)1-2-6(5)9/h1-3,9H
InChIKeyQYOQXDXBVDJMAY-UHFFFAOYSA-N
MW227.07 g/mol
LogP1.97
Rot. Bonds1

About 3-chloro-4-hydroxybenzenesulfonyl chloride

3-chloro-4-hydroxybenzenesulfonyl chloride (PubChem CID 22999325) has the molecular formula C6H4Cl2O3S and a molecular weight of 227.07 g/mol. Its IUPAC name is 3-chloro-4-hydroxybenzenesulfonyl chloride.

Molecular Properties

Compound Name3-chloro-4-hydroxybenzenesulfonyl chloride
PubChem CID22999325
Molecular FormulaC6H4Cl2O3S
Molecular Weight227.07 g/mol
Exact Mass225.93
IUPAC Name3-chloro-4-hydroxybenzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(O)c(Cl)c1
InChIInChI=1S/C6H4Cl2O3S/c7-5-3-4(12(8,10)11)1-2-6(5)9/h1-3,9H
InChIKeyQYOQXDXBVDJMAY-UHFFFAOYSA-N
XLogP1.97
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.07
LogP ≤ 51.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-chloro-4-hydroxybenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chloro-4-hydroxybenzenesulfonyl chloride?
The IUPAC name of 3-chloro-4-hydroxybenzenesulfonyl chloride (CID 22999325) is 3-chloro-4-hydroxybenzenesulfonyl chloride.
What is the SMILES notation for 3-chloro-4-hydroxybenzenesulfonyl chloride?
The canonical SMILES for 3-chloro-4-hydroxybenzenesulfonyl chloride is O=S(=O)(Cl)c1ccc(O)c(Cl)c1.
What is the InChIKey of 3-chloro-4-hydroxybenzenesulfonyl chloride?
The InChIKey is QYOQXDXBVDJMAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2O3S/c7-5-3-4(12(8,10)11)1-2-6(5)9/h1-3,9H.
What are the key properties of 3-chloro-4-hydroxybenzenesulfonyl chloride?
3-chloro-4-hydroxybenzenesulfonyl chloride has a molecular weight of 227.07 g/mol, XLogP of 1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-hydroxybenzenesulfonyl chloride is sourced from PubChem (CID 22999325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).