C11H20N2O — CID 22999556
1-(3,3,5,5-tetramethylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 22999556) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-(3,3,5,5-tetramethylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | 1-(3,3,5,5-tetramethylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 22999556 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-(3,3,5,5-tetramethylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C11H20N2O/c1-6-9(14)13-7-10(2,3)12-11(4,5)8-13/h6,12H,1,7-8H2,2-5H3 |
| InChIKey | XNDJVINYLPXSOO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|