About N-anilinocarbamate
N-anilinocarbamate (PubChem CID 23000131) has the molecular formula C7H7N2O2-
and a molecular weight of 151.14 g/mol. Its IUPAC name is N-anilinocarbamate.
Molecular Properties
| Compound Name | N-anilinocarbamate |
| PubChem CID | 23000131 |
| Molecular Formula | C7H7N2O2- |
| Molecular Weight | 151.14 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | N-anilinocarbamate |
| SMILES | O=C([O-])NNc1ccccc1 |
| InChI | InChI=1S/C7H8N2O2/c10-7(11)9-8-6-4-2-1-3-5-6/h1-5,8-9H,(H,10,11)/p-1 |
| InChIKey | POJYSQCMDUIYSB-UHFFFAOYSA-M |
| XLogP | -0.05 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.14 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-anilinocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-anilinocarbamate?
The IUPAC name of N-anilinocarbamate (CID 23000131) is N-anilinocarbamate.
What is the SMILES notation for N-anilinocarbamate?
The canonical SMILES for N-anilinocarbamate is O=C([O-])NNc1ccccc1.
What is the InChIKey of N-anilinocarbamate?
The InChIKey is POJYSQCMDUIYSB-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8N2O2/c10-7(11)9-8-6-4-2-1-3-5-6/h1-5,8-9H,(H,10,11)/p-1.
What are the key properties of N-anilinocarbamate?
N-anilinocarbamate has a molecular weight of 151.14 g/mol, XLogP of -0.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-anilinocarbamate is sourced from PubChem (CID 23000131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).