C12H16N2O2 — CID 23000180
ethyl 4-pyridin-2-ylpyrrolidine-3-carboxylate (PubChem CID 23000180) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is ethyl 4-pyridin-2-ylpyrrolidine-3-carboxylate.
| Compound Name | ethyl 4-pyridin-2-ylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 23000180 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | ethyl 4-pyridin-2-ylpyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1CNCC1c1ccccn1 |
| InChI | InChI=1S/C12H16N2O2/c1-2-16-12(15)10-8-13-7-9(10)11-5-3-4-6-14-11/h3-6,9-10,13H,2,7-8H2,1H3 |
| InChIKey | UXWYDCAPQPYWIH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |