About 2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ylmethanamine;dihydrochloride
2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ylmethanamine;dihydrochloride (PubChem CID 23000261) has the molecular formula C8H13Cl2N3
and a molecular weight of 222.12 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ylmethanamine;dihydrochloride.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ylmethanamine;dihydrochloride |
| PubChem CID | 23000261 |
| Molecular Formula | C8H13Cl2N3 |
| Molecular Weight | 222.12 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ylmethanamine;dihydrochloride |
| SMILES | Cl.Cl.NCc1cnc2c(c1)CCN2 |
| InChI | InChI=1S/C8H11N3.2ClH/c9-4-6-3-7-1-2-10-8(7)11-5-6;;/h3,5H,1-2,4,9H2,(H,10,11);2*1H |
| InChIKey | BGRDFGFWUFBODZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.12 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ylmethanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ylmethanamine;dihydrochloride?
The IUPAC name of 2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ylmethanamine;dihydrochloride (CID 23000261) is 2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ylmethanamine;dihydrochloride.
What is the SMILES notation for 2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ylmethanamine;dihydrochloride?
The canonical SMILES for 2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ylmethanamine;dihydrochloride is Cl.Cl.NCc1cnc2c(c1)CCN2.
What is the InChIKey of 2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ylmethanamine;dihydrochloride?
The InChIKey is BGRDFGFWUFBODZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3.2ClH/c9-4-6-3-7-1-2-10-8(7)11-5-6;;/h3,5H,1-2,4,9H2,(H,10,11);2*1H.
What are the key properties of 2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ylmethanamine;dihydrochloride?
2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ylmethanamine;dihydrochloride has a molecular weight of 222.12 g/mol, XLogP of 1.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ylmethanamine;dihydrochloride is sourced from PubChem (CID 23000261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).