About methyl 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]acetate
methyl 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]acetate (PubChem CID 23000564) has the molecular formula C16H15F2NO4S
and a molecular weight of 355.36 g/mol. Its IUPAC name is methyl 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]acetate |
| PubChem CID | 23000564 |
| Molecular Formula | C16H15F2NO4S |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | methyl 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]acetate |
| SMILES | COC(=O)Cc1c(F)ccc(NS(=O)(=O)Cc2ccccc2)c1F |
| InChI | InChI=1S/C16H15F2NO4S/c1-23-15(20)9-12-13(17)7-8-14(16(12)18)19-24(21,22)10-11-5-3-2-4-6-11/h2-8,19H,9-10H2,1H3 |
| InChIKey | NAJKYKUVOYHFDZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]acetate?
The IUPAC name of methyl 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]acetate (CID 23000564) is methyl 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]acetate.
What is the SMILES notation for methyl 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]acetate?
The canonical SMILES for methyl 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]acetate is COC(=O)Cc1c(F)ccc(NS(=O)(=O)Cc2ccccc2)c1F.
What is the InChIKey of methyl 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]acetate?
The InChIKey is NAJKYKUVOYHFDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F2NO4S/c1-23-15(20)9-12-13(17)7-8-14(16(12)18)19-24(21,22)10-11-5-3-2-4-6-11/h2-8,19H,9-10H2,1H3.
What are the key properties of methyl 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]acetate?
methyl 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]acetate has a molecular weight of 355.36 g/mol, XLogP of 2.62, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(benzylsulfonylamino)-2,6-difluorophenyl]acetate is sourced from PubChem (CID 23000564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).