C16H14ClF4N3O2 — CID 23000565
ethyl 2-[5-chloro-2-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]-3,6-difluoro-4-pyridinyl]acetate (PubChem CID 23000565) has the molecular formula C16H14ClF4N3O2 and a molecular weight of 391.75 g/mol. Its IUPAC name is ethyl 2-[5-chloro-2-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]-3,6-difluoro-4-pyridinyl]acetate.
| Compound Name | ethyl 2-[5-chloro-2-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]-3,6-difluoro-4-pyridinyl]acetate |
|---|---|
| PubChem CID | 23000565 |
| Molecular Formula | C16H14ClF4N3O2 |
| Molecular Weight | 391.75 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | ethyl 2-[5-chloro-2-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]-3,6-difluoro-4-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1c(F)c(NCC(F)(F)c2ccccn2)nc(F)c1Cl |
| InChI | InChI=1S/C16H14ClF4N3O2/c1-2-26-11(25)7-9-12(17)14(19)24-15(13(9)18)23-8-16(20,21)10-5-3-4-6-22-10/h3-6H,2,7-8H2,1H3,(H,23,24) |
| InChIKey | VHIMPLLHAPDGPV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.75 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|