C13H22NO4S- — CID 23000734
1-(cyclohexylmethylsulfonyl)piperidine-2-carboxylate (PubChem CID 23000734) has the molecular formula C13H22NO4S- and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-(cyclohexylmethylsulfonyl)piperidine-2-carboxylate.
| Compound Name | 1-(cyclohexylmethylsulfonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 23000734 |
| Molecular Formula | C13H22NO4S- |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-(cyclohexylmethylsulfonyl)piperidine-2-carboxylate |
| SMILES | O=C([O-])C1CCCCN1S(=O)(=O)CC1CCCCC1 |
| InChI | InChI=1S/C13H23NO4S/c15-13(16)12-8-4-5-9-14(12)19(17,18)10-11-6-2-1-3-7-11/h11-12H,1-10H2,(H,15,16)/p-1 |
| InChIKey | VDECHYJQFFKBRA-UHFFFAOYSA-M |
| XLogP | 0.50 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |