C32H33ClN4O2 — CID 23001192
2-(2-aminoethoxymethyl)-4-(3-chlorophenyl)-5-cyano-N-(3,3-diphenylpropyl)-6-methyl-1,4-dihydropyridine-3-carboxamide (PubChem CID 23001192) has the molecular formula C32H33ClN4O2 and a molecular weight of 541.10 g/mol. Its IUPAC name is 2-(2-aminoethoxymethyl)-4-(3-chlorophenyl)-5-cyano-N-(3,3-diphenylpropyl)-6-methyl-1,4-dihydropyridine-3-carboxamide.
| Compound Name | 2-(2-aminoethoxymethyl)-4-(3-chlorophenyl)-5-cyano-N-(3,3-diphenylpropyl)-6-methyl-1,4-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 23001192 |
| Molecular Formula | C32H33ClN4O2 |
| Molecular Weight | 541.10 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 2-(2-aminoethoxymethyl)-4-(3-chlorophenyl)-5-cyano-N-(3,3-diphenylpropyl)-6-methyl-1,4-dihydropyridine-3-carboxamide |
| SMILES | CC1=C(C#N)C(c2cccc(Cl)c2)C(C(=O)NCCC(c2ccccc2)c2ccccc2)=C(COCCN)N1 |
| InChI | InChI=1S/C32H33ClN4O2/c1-22-28(20-35)30(25-13-8-14-26(33)19-25)31(29(37-22)21-39-18-16-34)32(38)36-17-15-27(23-9-4-2-5-10-23)24-11-6-3-7-12-24/h2-14,19,27,30,37H,15-18,21,34H2,1H3,(H,36,38) |
| InChIKey | BSQUIVDBKYKTSC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.10 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|