C35H33F3N2O — CID 23001267
5-[[3-(trifluoromethyl)phenyl]methoxymethyl]-3-trityl-1,2,4,5,6,7-hexahydrobenzimidazole (PubChem CID 23001267) has the molecular formula C35H33F3N2O and a molecular weight of 554.66 g/mol. Its IUPAC name is 5-[[3-(trifluoromethyl)phenyl]methoxymethyl]-3-trityl-1,2,4,5,6,7-hexahydrobenzimidazole.
| Compound Name | 5-[[3-(trifluoromethyl)phenyl]methoxymethyl]-3-trityl-1,2,4,5,6,7-hexahydrobenzimidazole |
|---|---|
| PubChem CID | 23001267 |
| Molecular Formula | C35H33F3N2O |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 5-[[3-(trifluoromethyl)phenyl]methoxymethyl]-3-trityl-1,2,4,5,6,7-hexahydrobenzimidazole |
| SMILES | FC(F)(F)c1cccc(COCC2CCC3=C(C2)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)CN3)c1 |
| InChI | InChI=1S/C35H33F3N2O/c36-35(37,38)31-18-10-11-26(21-31)23-41-24-27-19-20-32-33(22-27)40(25-39-32)34(28-12-4-1-5-13-28,29-14-6-2-7-15-29)30-16-8-3-9-17-30/h1-18,21,27,39H,19-20,22-25H2 |
| InChIKey | HBQOUGNAYUIKNT-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|