About 2-(6-fluoro-2-methoxy-3H-1,4-benzodioxin-2-yl)-4,5-dihydro-1H-imidazole
2-(6-fluoro-2-methoxy-3H-1,4-benzodioxin-2-yl)-4,5-dihydro-1H-imidazole (PubChem CID 23001347) has the molecular formula C12H13FN2O3
and a molecular weight of 252.24 g/mol. Its IUPAC name is 2-(6-fluoro-2-methoxy-3H-1,4-benzodioxin-2-yl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-(6-fluoro-2-methoxy-3H-1,4-benzodioxin-2-yl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 23001347 |
| Molecular Formula | C12H13FN2O3 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-(6-fluoro-2-methoxy-3H-1,4-benzodioxin-2-yl)-4,5-dihydro-1H-imidazole |
| SMILES | COC1(C2=NCCN2)COc2cc(F)ccc2O1 |
| InChI | InChI=1S/C12H13FN2O3/c1-16-12(11-14-4-5-15-11)7-17-10-6-8(13)2-3-9(10)18-12/h2-3,6H,4-5,7H2,1H3,(H,14,15) |
| InChIKey | VFOYFIVCTYQRBE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(6-fluoro-2-methoxy-3H-1,4-benzodioxin-2-yl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoro-2-methoxy-3H-1,4-benzodioxin-2-yl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-(6-fluoro-2-methoxy-3H-1,4-benzodioxin-2-yl)-4,5-dihydro-1H-imidazole (CID 23001347) is 2-(6-fluoro-2-methoxy-3H-1,4-benzodioxin-2-yl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-(6-fluoro-2-methoxy-3H-1,4-benzodioxin-2-yl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-(6-fluoro-2-methoxy-3H-1,4-benzodioxin-2-yl)-4,5-dihydro-1H-imidazole is COC1(C2=NCCN2)COc2cc(F)ccc2O1.
What is the InChIKey of 2-(6-fluoro-2-methoxy-3H-1,4-benzodioxin-2-yl)-4,5-dihydro-1H-imidazole?
The InChIKey is VFOYFIVCTYQRBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2O3/c1-16-12(11-14-4-5-15-11)7-17-10-6-8(13)2-3-9(10)18-12/h2-3,6H,4-5,7H2,1H3,(H,14,15).
What are the key properties of 2-(6-fluoro-2-methoxy-3H-1,4-benzodioxin-2-yl)-4,5-dihydro-1H-imidazole?
2-(6-fluoro-2-methoxy-3H-1,4-benzodioxin-2-yl)-4,5-dihydro-1H-imidazole has a molecular weight of 252.24 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoro-2-methoxy-3H-1,4-benzodioxin-2-yl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 23001347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).