C20H25N3O4S — CID 23001488
2-[3-[5-[(3,5-dimethylphenoxy)methyl]-1,3-thiazol-2-yl]-3-methyl-2-oxopyrrolidin-1-yl]-N-hydroxypropanamide (PubChem CID 23001488) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is 2-[3-[5-[(3,5-dimethylphenoxy)methyl]-1,3-thiazol-2-yl]-3-methyl-2-oxopyrrolidin-1-yl]-N-hydroxypropanamide.
| Compound Name | 2-[3-[5-[(3,5-dimethylphenoxy)methyl]-1,3-thiazol-2-yl]-3-methyl-2-oxopyrrolidin-1-yl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 23001488 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-[3-[5-[(3,5-dimethylphenoxy)methyl]-1,3-thiazol-2-yl]-3-methyl-2-oxopyrrolidin-1-yl]-N-hydroxypropanamide |
| SMILES | Cc1cc(C)cc(OCc2cnc(C3(C)CCN(C(C)C(=O)NO)C3=O)s2)c1 |
| InChI | InChI=1S/C20H25N3O4S/c1-12-7-13(2)9-15(8-12)27-11-16-10-21-18(28-16)20(4)5-6-23(19(20)25)14(3)17(24)22-26/h7-10,14,26H,5-6,11H2,1-4H3,(H,22,24) |
| InChIKey | FEXYTFIUBSCNMY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|