About trimethoxy(6,6,6-trifluorohexyl)silane
trimethoxy(6,6,6-trifluorohexyl)silane (PubChem CID 23001897) has the molecular formula C9H19F3O3Si
and a molecular weight of 260.33 g/mol. Its IUPAC name is trimethoxy(6,6,6-trifluorohexyl)silane.
Molecular Properties
| Compound Name | trimethoxy(6,6,6-trifluorohexyl)silane |
| PubChem CID | 23001897 |
| Molecular Formula | C9H19F3O3Si |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | trimethoxy(6,6,6-trifluorohexyl)silane |
| SMILES | CO[Si](CCCCCC(F)(F)F)(OC)OC |
| InChI | InChI=1S/C9H19F3O3Si/c1-13-16(14-2,15-3)8-6-4-5-7-9(10,11)12/h4-8H2,1-3H3 |
| InChIKey | CERVGQPARMTDQC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethoxy(6,6,6-trifluorohexyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxy(6,6,6-trifluorohexyl)silane?
The IUPAC name of trimethoxy(6,6,6-trifluorohexyl)silane (CID 23001897) is trimethoxy(6,6,6-trifluorohexyl)silane.
What is the SMILES notation for trimethoxy(6,6,6-trifluorohexyl)silane?
The canonical SMILES for trimethoxy(6,6,6-trifluorohexyl)silane is CO[Si](CCCCCC(F)(F)F)(OC)OC.
What is the InChIKey of trimethoxy(6,6,6-trifluorohexyl)silane?
The InChIKey is CERVGQPARMTDQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F3O3Si/c1-13-16(14-2,15-3)8-6-4-5-7-9(10,11)12/h4-8H2,1-3H3.
What are the key properties of trimethoxy(6,6,6-trifluorohexyl)silane?
trimethoxy(6,6,6-trifluorohexyl)silane has a molecular weight of 260.33 g/mol, XLogP of 2.99, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxy(6,6,6-trifluorohexyl)silane is sourced from PubChem (CID 23001897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).