C50H67O3P — CID 23002702
bis(3,6-ditert-butylnaphthalen-2-yl) (2,4-ditert-butylphenyl) phosphite (PubChem CID 23002702) has the molecular formula C50H67O3P and a molecular weight of 747.06 g/mol. Its IUPAC name is bis(3,6-ditert-butylnaphthalen-2-yl) (2,4-ditert-butylphenyl) phosphite.
| Compound Name | bis(3,6-ditert-butylnaphthalen-2-yl) (2,4-ditert-butylphenyl) phosphite |
|---|---|
| PubChem CID | 23002702 |
| Molecular Formula | C50H67O3P |
| Molecular Weight | 747.06 g/mol |
| Exact Mass | 746.48 |
| IUPAC Name | bis(3,6-ditert-butylnaphthalen-2-yl) (2,4-ditert-butylphenyl) phosphite |
| SMILES | CC(C)(C)c1ccc(OP(Oc2cc3ccc(C(C)(C)C)cc3cc2C(C)(C)C)Oc2cc3ccc(C(C)(C)C)cc3cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C50H67O3P/c1-45(2,3)36-21-19-32-29-43(39(48(10,11)12)27-34(32)25-36)52-54(51-42-24-23-38(47(7,8)9)31-41(42)50(16,17)18)53-44-30-33-20-22-37(46(4,5)6)26-35(33)28-40(44)49(13,14)15/h19-31H,1-18H3 |
| InChIKey | ZXUJJDHHRJYFQC-UHFFFAOYSA-N |
| XLogP | 15.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.06 |
| LogP ≤ 5 | 15.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|