About 1,3-bis(sulfanyl)propan-2-ol;bis(2-(1-hydroxybutan-2-ylsulfanyl)butan-1-ol)
1,3-bis(sulfanyl)propan-2-ol;bis(2-(1-hydroxybutan-2-ylsulfanyl)butan-1-ol) (PubChem CID 23002779) has the molecular formula C19H44O5S4
and a molecular weight of 480.82 g/mol. Its IUPAC name is 1,3-bis(sulfanyl)propan-2-ol;bis(2-(1-hydroxybutan-2-ylsulfanyl)butan-1-ol).
Molecular Properties
| Compound Name | 1,3-bis(sulfanyl)propan-2-ol;bis(2-(1-hydroxybutan-2-ylsulfanyl)butan-1-ol) |
| PubChem CID | 23002779 |
| Molecular Formula | C19H44O5S4 |
| Molecular Weight | 480.82 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 1,3-bis(sulfanyl)propan-2-ol;bis(2-(1-hydroxybutan-2-ylsulfanyl)butan-1-ol) |
| SMILES | CCC(CO)SC(CC)CO.CCC(CO)SC(CC)CO.OC(CS)CS |
| InChI | InChI=1S/2C8H18O2S.C3H8OS2/c2*1-3-7(5-9)11-8(4-2)6-10;4-3(1-5)2-6/h2*7-10H,3-6H2,1-2H3;3-6H,1-2H2 |
| InChIKey | NTKROUBKPKLAES-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.82 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(sulfanyl)propan-2-ol;bis(2-(1-hydroxybutan-2-ylsulfanyl)butan-1-ol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(sulfanyl)propan-2-ol;bis(2-(1-hydroxybutan-2-ylsulfanyl)butan-1-ol)?
The IUPAC name of 1,3-bis(sulfanyl)propan-2-ol;bis(2-(1-hydroxybutan-2-ylsulfanyl)butan-1-ol) (CID 23002779) is 1,3-bis(sulfanyl)propan-2-ol;bis(2-(1-hydroxybutan-2-ylsulfanyl)butan-1-ol).
What is the SMILES notation for 1,3-bis(sulfanyl)propan-2-ol;bis(2-(1-hydroxybutan-2-ylsulfanyl)butan-1-ol)?
The canonical SMILES for 1,3-bis(sulfanyl)propan-2-ol;bis(2-(1-hydroxybutan-2-ylsulfanyl)butan-1-ol) is CCC(CO)SC(CC)CO.CCC(CO)SC(CC)CO.OC(CS)CS.
What is the InChIKey of 1,3-bis(sulfanyl)propan-2-ol;bis(2-(1-hydroxybutan-2-ylsulfanyl)butan-1-ol)?
The InChIKey is NTKROUBKPKLAES-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H18O2S.C3H8OS2/c2*1-3-7(5-9)11-8(4-2)6-10;4-3(1-5)2-6/h2*7-10H,3-6H2,1-2H3;3-6H,1-2H2.
What are the key properties of 1,3-bis(sulfanyl)propan-2-ol;bis(2-(1-hydroxybutan-2-ylsulfanyl)butan-1-ol)?
1,3-bis(sulfanyl)propan-2-ol;bis(2-(1-hydroxybutan-2-ylsulfanyl)butan-1-ol) has a molecular weight of 480.82 g/mol, XLogP of 2.73, 14 rotatable bonds, 7 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(sulfanyl)propan-2-ol;bis(2-(1-hydroxybutan-2-ylsulfanyl)butan-1-ol) is sourced from PubChem (CID 23002779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).