About 3-ethylcarbazol-3-amine
3-ethylcarbazol-3-amine (PubChem CID 23002910) has the molecular formula C14H14N2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-ethylcarbazol-3-amine.
Molecular Properties
| Compound Name | 3-ethylcarbazol-3-amine |
| PubChem CID | 23002910 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 3-ethylcarbazol-3-amine |
| SMILES | CCC1(N)C=CC2=Nc3ccccc3C2=C1 |
| InChI | InChI=1S/C14H14N2/c1-2-14(15)8-7-13-11(9-14)10-5-3-4-6-12(10)16-13/h3-9H,2,15H2,1H3 |
| InChIKey | FOKICSFOVBIWBO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethylcarbazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylcarbazol-3-amine?
The IUPAC name of 3-ethylcarbazol-3-amine (CID 23002910) is 3-ethylcarbazol-3-amine.
What is the SMILES notation for 3-ethylcarbazol-3-amine?
The canonical SMILES for 3-ethylcarbazol-3-amine is CCC1(N)C=CC2=Nc3ccccc3C2=C1.
What is the InChIKey of 3-ethylcarbazol-3-amine?
The InChIKey is FOKICSFOVBIWBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2/c1-2-14(15)8-7-13-11(9-14)10-5-3-4-6-12(10)16-13/h3-9H,2,15H2,1H3.
What are the key properties of 3-ethylcarbazol-3-amine?
3-ethylcarbazol-3-amine has a molecular weight of 210.28 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylcarbazol-3-amine is sourced from PubChem (CID 23002910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).