About tert-butyl 5-[2,6-dimethyl-4-(oxaldehydoyloxyamino)phenoxy]-3-pentylindazole-1-carboxylate
tert-butyl 5-[2,6-dimethyl-4-(oxaldehydoyloxyamino)phenoxy]-3-pentylindazole-1-carboxylate (PubChem CID 23003052) has the molecular formula C27H33N3O6
and a molecular weight of 495.58 g/mol. Its IUPAC name is tert-butyl 5-[2,6-dimethyl-4-(oxaldehydoyloxyamino)phenoxy]-3-pentylindazole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 5-[2,6-dimethyl-4-(oxaldehydoyloxyamino)phenoxy]-3-pentylindazole-1-carboxylate |
| PubChem CID | 23003052 |
| Molecular Formula | C27H33N3O6 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | tert-butyl 5-[2,6-dimethyl-4-(oxaldehydoyloxyamino)phenoxy]-3-pentylindazole-1-carboxylate |
| SMILES | CCCCCc1nn(C(=O)OC(C)(C)C)c2ccc(Oc3c(C)cc(NOC(=O)C=O)cc3C)cc12 |
| InChI | InChI=1S/C27H33N3O6/c1-7-8-9-10-22-21-15-20(11-12-23(21)30(28-22)26(33)35-27(4,5)6)34-25-17(2)13-19(14-18(25)3)29-36-24(32)16-31/h11-16,29H,7-10H2,1-6H3 |
| InChIKey | BGMZBEBFJJQWRL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 5-[2,6-dimethyl-4-(oxaldehydoyloxyamino)phenoxy]-3-pentylindazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-[2,6-dimethyl-4-(oxaldehydoyloxyamino)phenoxy]-3-pentylindazole-1-carboxylate?
The IUPAC name of tert-butyl 5-[2,6-dimethyl-4-(oxaldehydoyloxyamino)phenoxy]-3-pentylindazole-1-carboxylate (CID 23003052) is tert-butyl 5-[2,6-dimethyl-4-(oxaldehydoyloxyamino)phenoxy]-3-pentylindazole-1-carboxylate.
What is the SMILES notation for tert-butyl 5-[2,6-dimethyl-4-(oxaldehydoyloxyamino)phenoxy]-3-pentylindazole-1-carboxylate?
The canonical SMILES for tert-butyl 5-[2,6-dimethyl-4-(oxaldehydoyloxyamino)phenoxy]-3-pentylindazole-1-carboxylate is CCCCCc1nn(C(=O)OC(C)(C)C)c2ccc(Oc3c(C)cc(NOC(=O)C=O)cc3C)cc12.
What is the InChIKey of tert-butyl 5-[2,6-dimethyl-4-(oxaldehydoyloxyamino)phenoxy]-3-pentylindazole-1-carboxylate?
The InChIKey is BGMZBEBFJJQWRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33N3O6/c1-7-8-9-10-22-21-15-20(11-12-23(21)30(28-22)26(33)35-27(4,5)6)34-25-17(2)13-19(14-18(25)3)29-36-24(32)16-31/h11-16,29H,7-10H2,1-6H3.
What are the key properties of tert-butyl 5-[2,6-dimethyl-4-(oxaldehydoyloxyamino)phenoxy]-3-pentylindazole-1-carboxylate?
tert-butyl 5-[2,6-dimethyl-4-(oxaldehydoyloxyamino)phenoxy]-3-pentylindazole-1-carboxylate has a molecular weight of 495.58 g/mol, XLogP of 6.03, 9 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-[2,6-dimethyl-4-(oxaldehydoyloxyamino)phenoxy]-3-pentylindazole-1-carboxylate is sourced from PubChem (CID 23003052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).