C20H19ClN2O4 — CID 23003451
2-[6-chloro-2-(3-ethoxy-4-ethylpyridine-2-carbonyl)-1H-indol-3-yl]acetic acid (PubChem CID 23003451) has the molecular formula C20H19ClN2O4 and a molecular weight of 386.84 g/mol. Its IUPAC name is 2-[6-chloro-2-(3-ethoxy-4-ethylpyridine-2-carbonyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[6-chloro-2-(3-ethoxy-4-ethylpyridine-2-carbonyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 23003451 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-[6-chloro-2-(3-ethoxy-4-ethylpyridine-2-carbonyl)-1H-indol-3-yl]acetic acid |
| SMILES | CCOc1c(CC)ccnc1C(=O)c1[nH]c2cc(Cl)ccc2c1CC(=O)O |
| InChI | InChI=1S/C20H19ClN2O4/c1-3-11-7-8-22-18(20(11)27-4-2)19(26)17-14(10-16(24)25)13-6-5-12(21)9-15(13)23-17/h5-9,23H,3-4,10H2,1-2H3,(H,24,25) |
| InChIKey | XOKAZAIZAKWWKK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|