C19H18N4O5S2 — CID 23004540
4-[(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)sulfonyl]-1-(2-phenylethyl)piperazine-2,6-dione (PubChem CID 23004540) has the molecular formula C19H18N4O5S2 and a molecular weight of 446.51 g/mol. Its IUPAC name is 4-[(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)sulfonyl]-1-(2-phenylethyl)piperazine-2,6-dione.
| Compound Name | 4-[(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)sulfonyl]-1-(2-phenylethyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 23004540 |
| Molecular Formula | C19H18N4O5S2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 4-[(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)sulfonyl]-1-(2-phenylethyl)piperazine-2,6-dione |
| SMILES | Cc1nc2sccn2c(=O)c1S(=O)(=O)N1CC(=O)N(CCc2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C19H18N4O5S2/c1-13-17(18(26)23-9-10-29-19(23)20-13)30(27,28)21-11-15(24)22(16(25)12-21)8-7-14-5-3-2-4-6-14/h2-6,9-10H,7-8,11-12H2,1H3 |
| InChIKey | FBKFUZFIUAJHOW-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 109.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|