About 2-piperidin-1-ylacetic acid chloride
2-piperidin-1-ylacetic acid chloride (PubChem CID 23004666) has the molecular formula C7H13ClNO2-
and a molecular weight of 178.64 g/mol. Its IUPAC name is 2-piperidin-1-ylacetic acid chloride.
Molecular Properties
| Compound Name | 2-piperidin-1-ylacetic acid chloride |
| PubChem CID | 23004666 |
| Molecular Formula | C7H13ClNO2- |
| Molecular Weight | 178.64 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 2-piperidin-1-ylacetic acid chloride |
| SMILES | O=C(O)CN1CCCCC1.[Cl-] |
| InChI | InChI=1S/C7H13NO2.ClH/c9-7(10)6-8-4-2-1-3-5-8;/h1-6H2,(H,9,10);1H/p-1 |
| InChIKey | WKVJGLBBPPFCGD-UHFFFAOYSA-M |
| XLogP | -2.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.64 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-piperidin-1-ylacetic acid chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylacetic acid chloride?
The IUPAC name of 2-piperidin-1-ylacetic acid chloride (CID 23004666) is 2-piperidin-1-ylacetic acid chloride.
What is the SMILES notation for 2-piperidin-1-ylacetic acid chloride?
The canonical SMILES for 2-piperidin-1-ylacetic acid chloride is O=C(O)CN1CCCCC1.[Cl-].
What is the InChIKey of 2-piperidin-1-ylacetic acid chloride?
The InChIKey is WKVJGLBBPPFCGD-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H13NO2.ClH/c9-7(10)6-8-4-2-1-3-5-8;/h1-6H2,(H,9,10);1H/p-1.
What are the key properties of 2-piperidin-1-ylacetic acid chloride?
2-piperidin-1-ylacetic acid chloride has a molecular weight of 178.64 g/mol, XLogP of -2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylacetic acid chloride is sourced from PubChem (CID 23004666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).