About (4,4-dimethyl-2,3-dihydrothiochromen-6-yl)boronic acid
(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)boronic acid (PubChem CID 23005446) has the molecular formula C11H15BO2S
and a molecular weight of 222.12 g/mol. Its IUPAC name is (4,4-dimethyl-2,3-dihydrothiochromen-6-yl)boronic acid.
Molecular Properties
| Compound Name | (4,4-dimethyl-2,3-dihydrothiochromen-6-yl)boronic acid |
| PubChem CID | 23005446 |
| Molecular Formula | C11H15BO2S |
| Molecular Weight | 222.12 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (4,4-dimethyl-2,3-dihydrothiochromen-6-yl)boronic acid |
| SMILES | CC1(C)CCSc2ccc(B(O)O)cc21 |
| InChI | InChI=1S/C11H15BO2S/c1-11(2)5-6-15-10-4-3-8(12(13)14)7-9(10)11/h3-4,7,13-14H,5-6H2,1-2H3 |
| InChIKey | VMWKJGMQVAFADM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.12 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4,4-dimethyl-2,3-dihydrothiochromen-6-yl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-dimethyl-2,3-dihydrothiochromen-6-yl)boronic acid?
The IUPAC name of (4,4-dimethyl-2,3-dihydrothiochromen-6-yl)boronic acid (CID 23005446) is (4,4-dimethyl-2,3-dihydrothiochromen-6-yl)boronic acid.
What is the SMILES notation for (4,4-dimethyl-2,3-dihydrothiochromen-6-yl)boronic acid?
The canonical SMILES for (4,4-dimethyl-2,3-dihydrothiochromen-6-yl)boronic acid is CC1(C)CCSc2ccc(B(O)O)cc21.
What is the InChIKey of (4,4-dimethyl-2,3-dihydrothiochromen-6-yl)boronic acid?
The InChIKey is VMWKJGMQVAFADM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BO2S/c1-11(2)5-6-15-10-4-3-8(12(13)14)7-9(10)11/h3-4,7,13-14H,5-6H2,1-2H3.
What are the key properties of (4,4-dimethyl-2,3-dihydrothiochromen-6-yl)boronic acid?
(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)boronic acid has a molecular weight of 222.12 g/mol, XLogP of 1.14, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-dimethyl-2,3-dihydrothiochromen-6-yl)boronic acid is sourced from PubChem (CID 23005446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).