C11H12ClN3 — CID 23005889
2-[5-(3-chlorophenyl)-1H-pyrazol-4-yl]ethanamine (PubChem CID 23005889) has the molecular formula C11H12ClN3 and a molecular weight of 221.69 g/mol. Its IUPAC name is 2-[5-(3-chlorophenyl)-1H-pyrazol-4-yl]ethanamine.
| Compound Name | 2-[5-(3-chlorophenyl)-1H-pyrazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 23005889 |
| Molecular Formula | C11H12ClN3 |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-[5-(3-chlorophenyl)-1H-pyrazol-4-yl]ethanamine |
| SMILES | NCCc1cn[nH]c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H12ClN3/c12-10-3-1-2-8(6-10)11-9(4-5-13)7-14-15-11/h1-3,6-7H,4-5,13H2,(H,14,15) |
| InChIKey | BQRCJAFRYSRHSO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |