3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid

C11H18N2O2 — CID 23005986

IUPAC3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid
SMILESCCCn1nc(C)c(CCC(=O)O)c1C
InChIInChI=1S/C11H18N2O2/c1-4-7-13-9(3)10(8(2)12-13)5-6-11(14)15/h4-7H2,1-3H3,(H,14,15)
InChIKeyQXQKSDQPTHDISC-UHFFFAOYSA-N
MW210.28 g/mol
LogP1.93
Rot. Bonds5

About 3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid

3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid (PubChem CID 23005986) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid.

Molecular Properties

Compound Name3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid
PubChem CID23005986
Molecular FormulaC11H18N2O2
Molecular Weight210.28 g/mol
Exact Mass210.14
IUPAC Name3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid
SMILESCCCn1nc(C)c(CCC(=O)O)c1C
InChIInChI=1S/C11H18N2O2/c1-4-7-13-9(3)10(8(2)12-13)5-6-11(14)15/h4-7H2,1-3H3,(H,14,15)
InChIKeyQXQKSDQPTHDISC-UHFFFAOYSA-N
XLogP1.93
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.28
LogP ≤ 51.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid?
The IUPAC name of 3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid (CID 23005986) is 3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid.
What is the SMILES notation for 3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid?
The canonical SMILES for 3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid is CCCn1nc(C)c(CCC(=O)O)c1C.
What is the InChIKey of 3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid?
The InChIKey is QXQKSDQPTHDISC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-4-7-13-9(3)10(8(2)12-13)5-6-11(14)15/h4-7H2,1-3H3,(H,14,15).
What are the key properties of 3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid?
3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid has a molecular weight of 210.28 g/mol, XLogP of 1.93, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-1-propylpyrazol-4-yl)propanoic acid is sourced from PubChem (CID 23005986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).