2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid

C10H14N2O3 — CID 23006096

IUPAC2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid
SMILESCC(=O)c1c(C)nn(C(C)C(=O)O)c1C
InChIInChI=1S/C10H14N2O3/c1-5-9(8(4)13)6(2)12(11-5)7(3)10(14)15/h7H,1-4H3,(H,14,15)
InChIKeyZOSLXAHKIQPODD-UHFFFAOYSA-N
MW210.23 g/mol
LogP1.35
Rot. Bonds3

About 2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid

2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid (PubChem CID 23006096) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid.

Molecular Properties

Compound Name2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid
PubChem CID23006096
Molecular FormulaC10H14N2O3
Molecular Weight210.23 g/mol
Exact Mass210.10
IUPAC Name2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid
SMILESCC(=O)c1c(C)nn(C(C)C(=O)O)c1C
InChIInChI=1S/C10H14N2O3/c1-5-9(8(4)13)6(2)12(11-5)7(3)10(14)15/h7H,1-4H3,(H,14,15)
InChIKeyZOSLXAHKIQPODD-UHFFFAOYSA-N
XLogP1.35
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 51.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid?
The IUPAC name of 2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid (CID 23006096) is 2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid.
What is the SMILES notation for 2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid?
The canonical SMILES for 2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid is CC(=O)c1c(C)nn(C(C)C(=O)O)c1C.
What is the InChIKey of 2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid?
The InChIKey is ZOSLXAHKIQPODD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c1-5-9(8(4)13)6(2)12(11-5)7(3)10(14)15/h7H,1-4H3,(H,14,15).
What are the key properties of 2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid?
2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid has a molecular weight of 210.23 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid is sourced from PubChem (CID 23006096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).