About 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropan-1-ol
3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropan-1-ol (PubChem CID 23006128) has the molecular formula C9H15BrN2O
and a molecular weight of 247.14 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropan-1-ol |
| PubChem CID | 23006128 |
| Molecular Formula | C9H15BrN2O |
| Molecular Weight | 247.14 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropan-1-ol |
| SMILES | Cc1nn(CC(C)CO)c(C)c1Br |
| InChI | InChI=1S/C9H15BrN2O/c1-6(5-13)4-12-8(3)9(10)7(2)11-12/h6,13H,4-5H2,1-3H3 |
| InChIKey | WIEVWAJKLKHQNP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.14 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropan-1-ol?
The IUPAC name of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropan-1-ol (CID 23006128) is 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropan-1-ol.
What is the SMILES notation for 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropan-1-ol?
The canonical SMILES for 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropan-1-ol is Cc1nn(CC(C)CO)c(C)c1Br.
What is the InChIKey of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropan-1-ol?
The InChIKey is WIEVWAJKLKHQNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15BrN2O/c1-6(5-13)4-12-8(3)9(10)7(2)11-12/h6,13H,4-5H2,1-3H3.
What are the key properties of 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropan-1-ol?
3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropan-1-ol has a molecular weight of 247.14 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropan-1-ol is sourced from PubChem (CID 23006128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).