About 1,3-diethylpyrazole
1,3-diethylpyrazole (PubChem CID 23006152) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 1,3-diethylpyrazole.
Molecular Properties
| Compound Name | 1,3-diethylpyrazole |
| PubChem CID | 23006152 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 1,3-diethylpyrazole |
| SMILES | CCc1ccn(CC)n1 |
| InChI | InChI=1S/C7H12N2/c1-3-7-5-6-9(4-2)8-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | MARPBYIVZUKMRU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-diethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethylpyrazole?
The IUPAC name of 1,3-diethylpyrazole (CID 23006152) is 1,3-diethylpyrazole.
What is the SMILES notation for 1,3-diethylpyrazole?
The canonical SMILES for 1,3-diethylpyrazole is CCc1ccn(CC)n1.
What is the InChIKey of 1,3-diethylpyrazole?
The InChIKey is MARPBYIVZUKMRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-3-7-5-6-9(4-2)8-7/h5-6H,3-4H2,1-2H3.
What are the key properties of 1,3-diethylpyrazole?
1,3-diethylpyrazole has a molecular weight of 124.19 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethylpyrazole is sourced from PubChem (CID 23006152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).