About 3-ethyl-1-propylpyrazole
3-ethyl-1-propylpyrazole (PubChem CID 23006154) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 3-ethyl-1-propylpyrazole.
Molecular Properties
| Compound Name | 3-ethyl-1-propylpyrazole |
| PubChem CID | 23006154 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 3-ethyl-1-propylpyrazole |
| SMILES | CCCn1ccc(CC)n1 |
| InChI | InChI=1S/C8H14N2/c1-3-6-10-7-5-8(4-2)9-10/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | UIGQYGPAPIIYBQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-1-propylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-propylpyrazole?
The IUPAC name of 3-ethyl-1-propylpyrazole (CID 23006154) is 3-ethyl-1-propylpyrazole.
What is the SMILES notation for 3-ethyl-1-propylpyrazole?
The canonical SMILES for 3-ethyl-1-propylpyrazole is CCCn1ccc(CC)n1.
What is the InChIKey of 3-ethyl-1-propylpyrazole?
The InChIKey is UIGQYGPAPIIYBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-3-6-10-7-5-8(4-2)9-10/h5,7H,3-4,6H2,1-2H3.
What are the key properties of 3-ethyl-1-propylpyrazole?
3-ethyl-1-propylpyrazole has a molecular weight of 138.21 g/mol, XLogP of 1.86, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-propylpyrazole is sourced from PubChem (CID 23006154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).