5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid

C11H9NO3 — CID 23006222

IUPAC5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid
SMILESCc1ccccc1-c1cc(C(=O)O)no1
InChIInChI=1S/C11H9NO3/c1-7-4-2-3-5-8(7)10-6-9(11(13)14)12-15-10/h2-6H,1H3,(H,13,14)
InChIKeyWYRHIMMIRUNJQP-UHFFFAOYSA-N
MW203.20 g/mol
LogP2.35
Rot. Bonds2

About 5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid

5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 23006222) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid
PubChem CID23006222
Molecular FormulaC11H9NO3
Molecular Weight203.20 g/mol
Exact Mass203.06
IUPAC Name5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid
SMILESCc1ccccc1-c1cc(C(=O)O)no1
InChIInChI=1S/C11H9NO3/c1-7-4-2-3-5-8(7)10-6-9(11(13)14)12-15-10/h2-6H,1H3,(H,13,14)
InChIKeyWYRHIMMIRUNJQP-UHFFFAOYSA-N
XLogP2.35
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.20
LogP ≤ 52.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid (CID 23006222) is 5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid is Cc1ccccc1-c1cc(C(=O)O)no1.
What is the InChIKey of 5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is WYRHIMMIRUNJQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c1-7-4-2-3-5-8(7)10-6-9(11(13)14)12-15-10/h2-6H,1H3,(H,13,14).
What are the key properties of 5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid?
5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 203.20 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methylphenyl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 23006222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).