About [5-(4-methylphenyl)-1,2-oxazol-3-yl]methanol
[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanol (PubChem CID 23006256) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is [5-(4-methylphenyl)-1,2-oxazol-3-yl]methanol.
Molecular Properties
| Compound Name | [5-(4-methylphenyl)-1,2-oxazol-3-yl]methanol |
| PubChem CID | 23006256 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | [5-(4-methylphenyl)-1,2-oxazol-3-yl]methanol |
| SMILES | Cc1ccc(-c2cc(CO)no2)cc1 |
| InChI | InChI=1S/C11H11NO2/c1-8-2-4-9(5-3-8)11-6-10(7-13)12-14-11/h2-6,13H,7H2,1H3 |
| InChIKey | YPDITGIFBYDNAC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-(4-methylphenyl)-1,2-oxazol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-methylphenyl)-1,2-oxazol-3-yl]methanol?
The IUPAC name of [5-(4-methylphenyl)-1,2-oxazol-3-yl]methanol (CID 23006256) is [5-(4-methylphenyl)-1,2-oxazol-3-yl]methanol.
What is the SMILES notation for [5-(4-methylphenyl)-1,2-oxazol-3-yl]methanol?
The canonical SMILES for [5-(4-methylphenyl)-1,2-oxazol-3-yl]methanol is Cc1ccc(-c2cc(CO)no2)cc1.
What is the InChIKey of [5-(4-methylphenyl)-1,2-oxazol-3-yl]methanol?
The InChIKey is YPDITGIFBYDNAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-8-2-4-9(5-3-8)11-6-10(7-13)12-14-11/h2-6,13H,7H2,1H3.
What are the key properties of [5-(4-methylphenyl)-1,2-oxazol-3-yl]methanol?
[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanol has a molecular weight of 189.21 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-methylphenyl)-1,2-oxazol-3-yl]methanol is sourced from PubChem (CID 23006256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).