About 5-(ethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid
5-(ethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 23006330) has the molecular formula C7H9NO3S
and a molecular weight of 187.22 g/mol. Its IUPAC name is 5-(ethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-(ethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 23006330 |
| Molecular Formula | C7H9NO3S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | 5-(ethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | CCSCc1cc(C(=O)O)no1 |
| InChI | InChI=1S/C7H9NO3S/c1-2-12-4-5-3-6(7(9)10)8-11-5/h3H,2,4H2,1H3,(H,9,10) |
| InChIKey | ROUKISNVBXHMEZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(ethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(ethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(ethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid (CID 23006330) is 5-(ethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(ethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(ethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid is CCSCc1cc(C(=O)O)no1.
What is the InChIKey of 5-(ethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is ROUKISNVBXHMEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3S/c1-2-12-4-5-3-6(7(9)10)8-11-5/h3H,2,4H2,1H3,(H,9,10).
What are the key properties of 5-(ethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid?
5-(ethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 187.22 g/mol, XLogP of 1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(ethylsulfanylmethyl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 23006330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).