About 4-(2,5-dichlorophenyl)-2-methylbut-3-yn-2-ol
4-(2,5-dichlorophenyl)-2-methylbut-3-yn-2-ol (PubChem CID 23006409) has the molecular formula C11H10Cl2O
and a molecular weight of 229.11 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)-2-methylbut-3-yn-2-ol.
Molecular Properties
| Compound Name | 4-(2,5-dichlorophenyl)-2-methylbut-3-yn-2-ol |
| PubChem CID | 23006409 |
| Molecular Formula | C11H10Cl2O |
| Molecular Weight | 229.11 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 4-(2,5-dichlorophenyl)-2-methylbut-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H10Cl2O/c1-11(2,14)6-5-8-7-9(12)3-4-10(8)13/h3-4,7,14H,1-2H3 |
| InChIKey | ANUFBLOXBCULDJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.11 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,5-dichlorophenyl)-2-methylbut-3-yn-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dichlorophenyl)-2-methylbut-3-yn-2-ol?
The IUPAC name of 4-(2,5-dichlorophenyl)-2-methylbut-3-yn-2-ol (CID 23006409) is 4-(2,5-dichlorophenyl)-2-methylbut-3-yn-2-ol.
What is the SMILES notation for 4-(2,5-dichlorophenyl)-2-methylbut-3-yn-2-ol?
The canonical SMILES for 4-(2,5-dichlorophenyl)-2-methylbut-3-yn-2-ol is CC(C)(O)C#Cc1cc(Cl)ccc1Cl.
What is the InChIKey of 4-(2,5-dichlorophenyl)-2-methylbut-3-yn-2-ol?
The InChIKey is ANUFBLOXBCULDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2O/c1-11(2,14)6-5-8-7-9(12)3-4-10(8)13/h3-4,7,14H,1-2H3.
What are the key properties of 4-(2,5-dichlorophenyl)-2-methylbut-3-yn-2-ol?
4-(2,5-dichlorophenyl)-2-methylbut-3-yn-2-ol has a molecular weight of 229.11 g/mol, XLogP of 3.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dichlorophenyl)-2-methylbut-3-yn-2-ol is sourced from PubChem (CID 23006409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).