C8H11N5OS — CID 23006492
4-amino-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 23006492) has the molecular formula C8H11N5OS and a molecular weight of 225.28 g/mol. Its IUPAC name is 4-amino-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 23006492 |
| Molecular Formula | C8H11N5OS |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 4-amino-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1noc(C)c1Cc1n[nH]c(=S)n1N |
| InChI | InChI=1S/C8H11N5OS/c1-4-6(5(2)14-12-4)3-7-10-11-8(15)13(7)9/h3,9H2,1-2H3,(H,11,15) |
| InChIKey | NKKMFAAHLSOLSU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|