About 3-(1,3,4-oxadiazol-2-ylsulfanyl)propanoic acid
3-(1,3,4-oxadiazol-2-ylsulfanyl)propanoic acid (PubChem CID 23006614) has the molecular formula C5H6N2O3S
and a molecular weight of 174.18 g/mol. Its IUPAC name is 3-(1,3,4-oxadiazol-2-ylsulfanyl)propanoic acid.
Molecular Properties
| Compound Name | 3-(1,3,4-oxadiazol-2-ylsulfanyl)propanoic acid |
| PubChem CID | 23006614 |
| Molecular Formula | C5H6N2O3S |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | 3-(1,3,4-oxadiazol-2-ylsulfanyl)propanoic acid |
| SMILES | O=C(O)CCSc1nnco1 |
| InChI | InChI=1S/C5H6N2O3S/c8-4(9)1-2-11-5-7-6-3-10-5/h3H,1-2H2,(H,8,9) |
| InChIKey | GZXVBBALAYEYDJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1,3,4-oxadiazol-2-ylsulfanyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3,4-oxadiazol-2-ylsulfanyl)propanoic acid?
The IUPAC name of 3-(1,3,4-oxadiazol-2-ylsulfanyl)propanoic acid (CID 23006614) is 3-(1,3,4-oxadiazol-2-ylsulfanyl)propanoic acid.
What is the SMILES notation for 3-(1,3,4-oxadiazol-2-ylsulfanyl)propanoic acid?
The canonical SMILES for 3-(1,3,4-oxadiazol-2-ylsulfanyl)propanoic acid is O=C(O)CCSc1nnco1.
What is the InChIKey of 3-(1,3,4-oxadiazol-2-ylsulfanyl)propanoic acid?
The InChIKey is GZXVBBALAYEYDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3S/c8-4(9)1-2-11-5-7-6-3-10-5/h3H,1-2H2,(H,8,9).
What are the key properties of 3-(1,3,4-oxadiazol-2-ylsulfanyl)propanoic acid?
3-(1,3,4-oxadiazol-2-ylsulfanyl)propanoic acid has a molecular weight of 174.18 g/mol, XLogP of 0.64, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3,4-oxadiazol-2-ylsulfanyl)propanoic acid is sourced from PubChem (CID 23006614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).