About 5-(2-fluorophenyl)-3H-1,3,4-thiadiazole-2-thione
5-(2-fluorophenyl)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 23007085) has the molecular formula C8H5FN2S2
and a molecular weight of 212.27 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-3H-1,3,4-thiadiazole-2-thione.
Molecular Properties
| Compound Name | 5-(2-fluorophenyl)-3H-1,3,4-thiadiazole-2-thione |
| PubChem CID | 23007085 |
| Molecular Formula | C8H5FN2S2 |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 5-(2-fluorophenyl)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | Fc1ccccc1-c1n[nH]c(=S)s1 |
| InChI | InChI=1S/C8H5FN2S2/c9-6-4-2-1-3-5(6)7-10-11-8(12)13-7/h1-4H,(H,11,12) |
| InChIKey | ZVJCJFRKVZOACW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-fluorophenyl)-3H-1,3,4-thiadiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluorophenyl)-3H-1,3,4-thiadiazole-2-thione?
The IUPAC name of 5-(2-fluorophenyl)-3H-1,3,4-thiadiazole-2-thione (CID 23007085) is 5-(2-fluorophenyl)-3H-1,3,4-thiadiazole-2-thione.
What is the SMILES notation for 5-(2-fluorophenyl)-3H-1,3,4-thiadiazole-2-thione?
The canonical SMILES for 5-(2-fluorophenyl)-3H-1,3,4-thiadiazole-2-thione is Fc1ccccc1-c1n[nH]c(=S)s1.
What is the InChIKey of 5-(2-fluorophenyl)-3H-1,3,4-thiadiazole-2-thione?
The InChIKey is ZVJCJFRKVZOACW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5FN2S2/c9-6-4-2-1-3-5(6)7-10-11-8(12)13-7/h1-4H,(H,11,12).
What are the key properties of 5-(2-fluorophenyl)-3H-1,3,4-thiadiazole-2-thione?
5-(2-fluorophenyl)-3H-1,3,4-thiadiazole-2-thione has a molecular weight of 212.27 g/mol, XLogP of 3.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluorophenyl)-3H-1,3,4-thiadiazole-2-thione is sourced from PubChem (CID 23007085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).