C13H17N3 — CID 23008413
12-propan-2-yl-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene (PubChem CID 23008413) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 12-propan-2-yl-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene.
| Compound Name | 12-propan-2-yl-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene |
|---|---|
| PubChem CID | 23008413 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 12-propan-2-yl-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene |
| SMILES | CC(C)N1CCc2[nH]c3ccncc3c2C1 |
| InChI | InChI=1S/C13H17N3/c1-9(2)16-6-4-13-11(8-16)10-7-14-5-3-12(10)15-13/h3,5,7,9,15H,4,6,8H2,1-2H3 |
| InChIKey | GKGUVUBJSWJMID-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |