C13H17N — CID 23008733
3-phenyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole (PubChem CID 23008733) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-phenyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole.
| Compound Name | 3-phenyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole |
|---|---|
| PubChem CID | 23008733 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 3-phenyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole |
| SMILES | c1ccc(C2CNC3CCCC32)cc1 |
| InChI | InChI=1S/C13H17N/c1-2-5-10(6-3-1)12-9-14-13-8-4-7-11(12)13/h1-3,5-6,11-14H,4,7-9H2 |
| InChIKey | ANUWJZVDTUHQRB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |