C14H19N — CID 23008734
3-phenyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole (PubChem CID 23008734) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-phenyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole.
| Compound Name | 3-phenyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
|---|---|
| PubChem CID | 23008734 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 3-phenyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
| SMILES | c1ccc(C2CNC3CCCCC32)cc1 |
| InChI | InChI=1S/C14H19N/c1-2-6-11(7-3-1)13-10-15-14-9-5-4-8-12(13)14/h1-3,6-7,12-15H,4-5,8-10H2 |
| InChIKey | UWANJFHETVWHSC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |