About 1,6-dimethyl-4-oxo-2,3-dihydropyridine-5-carboxylic acid
1,6-dimethyl-4-oxo-2,3-dihydropyridine-5-carboxylic acid (PubChem CID 23008812) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 1,6-dimethyl-4-oxo-2,3-dihydropyridine-5-carboxylic acid.
Molecular Properties
| Compound Name | 1,6-dimethyl-4-oxo-2,3-dihydropyridine-5-carboxylic acid |
| PubChem CID | 23008812 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 1,6-dimethyl-4-oxo-2,3-dihydropyridine-5-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(=O)CCN1C |
| InChI | InChI=1S/C8H11NO3/c1-5-7(8(11)12)6(10)3-4-9(5)2/h3-4H2,1-2H3,(H,11,12) |
| InChIKey | MQSRPPATZJWXRM-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dimethyl-4-oxo-2,3-dihydropyridine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-4-oxo-2,3-dihydropyridine-5-carboxylic acid?
The IUPAC name of 1,6-dimethyl-4-oxo-2,3-dihydropyridine-5-carboxylic acid (CID 23008812) is 1,6-dimethyl-4-oxo-2,3-dihydropyridine-5-carboxylic acid.
What is the SMILES notation for 1,6-dimethyl-4-oxo-2,3-dihydropyridine-5-carboxylic acid?
The canonical SMILES for 1,6-dimethyl-4-oxo-2,3-dihydropyridine-5-carboxylic acid is CC1=C(C(=O)O)C(=O)CCN1C.
What is the InChIKey of 1,6-dimethyl-4-oxo-2,3-dihydropyridine-5-carboxylic acid?
The InChIKey is MQSRPPATZJWXRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-5-7(8(11)12)6(10)3-4-9(5)2/h3-4H2,1-2H3,(H,11,12).
What are the key properties of 1,6-dimethyl-4-oxo-2,3-dihydropyridine-5-carboxylic acid?
1,6-dimethyl-4-oxo-2,3-dihydropyridine-5-carboxylic acid has a molecular weight of 169.18 g/mol, XLogP of 0.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-4-oxo-2,3-dihydropyridine-5-carboxylic acid is sourced from PubChem (CID 23008812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).