About 4-aminopyrazolidin-3-one
4-aminopyrazolidin-3-one (PubChem CID 23009065) has the molecular formula C3H7N3O
and a molecular weight of 101.11 g/mol. Its IUPAC name is 4-aminopyrazolidin-3-one.
Molecular Properties
| Compound Name | 4-aminopyrazolidin-3-one |
| PubChem CID | 23009065 |
| Molecular Formula | C3H7N3O |
| Molecular Weight | 101.11 g/mol |
| Exact Mass | 101.06 |
| IUPAC Name | 4-aminopyrazolidin-3-one |
| SMILES | NC1CNNC1=O |
| InChI | InChI=1S/C3H7N3O/c4-2-1-5-6-3(2)7/h2,5H,1,4H2,(H,6,7) |
| InChIKey | UHVYZFNUNCKZAU-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.11 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-aminopyrazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminopyrazolidin-3-one?
The IUPAC name of 4-aminopyrazolidin-3-one (CID 23009065) is 4-aminopyrazolidin-3-one.
What is the SMILES notation for 4-aminopyrazolidin-3-one?
The canonical SMILES for 4-aminopyrazolidin-3-one is NC1CNNC1=O.
What is the InChIKey of 4-aminopyrazolidin-3-one?
The InChIKey is UHVYZFNUNCKZAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N3O/c4-2-1-5-6-3(2)7/h2,5H,1,4H2,(H,6,7).
What are the key properties of 4-aminopyrazolidin-3-one?
4-aminopyrazolidin-3-one has a molecular weight of 101.11 g/mol, XLogP of -2.05, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminopyrazolidin-3-one is sourced from PubChem (CID 23009065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).