C13H14N2O6 — CID 23009689
ethyl (E)-3-(2,4-dimethyl-3,5-dinitrophenyl)prop-2-enoate (PubChem CID 23009689) has the molecular formula C13H14N2O6 and a molecular weight of 294.26 g/mol. Its IUPAC name is ethyl (E)-3-(2,4-dimethyl-3,5-dinitrophenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(2,4-dimethyl-3,5-dinitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 23009689 |
| Molecular Formula | C13H14N2O6 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | ethyl (E)-3-(2,4-dimethyl-3,5-dinitrophenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C13H14N2O6/c1-4-21-12(16)6-5-10-7-11(14(17)18)9(3)13(8(10)2)15(19)20/h5-7H,4H2,1-3H3/b6-5+ |
| InChIKey | BRHWCCWZYWXKIV-AATRIKPKSA-N |
| XLogP | 2.70 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|